C33H36N4O3 — CID 118282789
12-(4-cyclohexylpiperazin-1-yl)-10-[4-(2-hydroxypropan-2-yl)anilino]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 118282789) has the molecular formula C33H36N4O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is 12-(4-cyclohexylpiperazin-1-yl)-10-[4-(2-hydroxypropan-2-yl)anilino]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-(4-cyclohexylpiperazin-1-yl)-10-[4-(2-hydroxypropan-2-yl)anilino]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 118282789 |
| Molecular Formula | C33H36N4O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 12-(4-cyclohexylpiperazin-1-yl)-10-[4-(2-hydroxypropan-2-yl)anilino]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | CC(C)(O)c1ccc(Nc2cc(N3CCN(C4CCCCC4)CC3)c3noc4c3c2C(=O)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C33H36N4O3/c1-33(2,39)21-12-14-22(15-13-21)34-26-20-27(37-18-16-36(17-19-37)23-8-4-3-5-9-23)30-29-28(26)31(38)24-10-6-7-11-25(24)32(29)40-35-30/h6-7,10-15,20,23,34,39H,3-5,8-9,16-19H2,1-2H3 |
| InChIKey | DMLMKDWRDYNREA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|