C29H30N4O3 — CID 20868166
12-(4-cyclohexylpiperazin-1-yl)-10-(furan-2-ylmethylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 20868166) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 12-(4-cyclohexylpiperazin-1-yl)-10-(furan-2-ylmethylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-(4-cyclohexylpiperazin-1-yl)-10-(furan-2-ylmethylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 20868166 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 12-(4-cyclohexylpiperazin-1-yl)-10-(furan-2-ylmethylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | O=C1c2ccccc2-c2onc3c(N4CCN(C5CCCCC5)CC4)cc(NCc4ccco4)c1c23 |
| InChI | InChI=1S/C29H30N4O3/c34-28-21-10-4-5-11-22(21)29-26-25(28)23(30-18-20-9-6-16-35-20)17-24(27(26)31-36-29)33-14-12-32(13-15-33)19-7-2-1-3-8-19/h4-6,9-11,16-17,19,30H,1-3,7-8,12-15,18H2 |
| InChIKey | AQWASLBEMRXALT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|