C28H22N4O5 — CID 20868172
12-[4-(furan-2-carbonyl)piperazin-1-yl]-10-(furan-2-ylmethylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 20868172) has the molecular formula C28H22N4O5 and a molecular weight of 494.51 g/mol. Its IUPAC name is 12-[4-(furan-2-carbonyl)piperazin-1-yl]-10-(furan-2-ylmethylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-[4-(furan-2-carbonyl)piperazin-1-yl]-10-(furan-2-ylmethylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 20868172 |
| Molecular Formula | C28H22N4O5 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 12-[4-(furan-2-carbonyl)piperazin-1-yl]-10-(furan-2-ylmethylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | O=C1c2ccccc2-c2onc3c(N4CCN(C(=O)c5ccco5)CC4)cc(NCc4ccco4)c1c23 |
| InChI | InChI=1S/C28H22N4O5/c33-26-18-6-1-2-7-19(18)27-24-23(26)20(29-16-17-5-3-13-35-17)15-21(25(24)30-37-27)31-9-11-32(12-10-31)28(34)22-8-4-14-36-22/h1-8,13-15,29H,9-12,16H2 |
| InChIKey | KDFMJNVMKPWLBZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|