C31H26N4O4 — CID 20868247
10-(2,5-dimethylanilino)-12-[4-(furan-2-carbonyl)piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 20868247) has the molecular formula C31H26N4O4 and a molecular weight of 518.57 g/mol. Its IUPAC name is 10-(2,5-dimethylanilino)-12-[4-(furan-2-carbonyl)piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 10-(2,5-dimethylanilino)-12-[4-(furan-2-carbonyl)piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 20868247 |
| Molecular Formula | C31H26N4O4 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 10-(2,5-dimethylanilino)-12-[4-(furan-2-carbonyl)piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | Cc1ccc(C)c(Nc2cc(N3CCN(C(=O)c4ccco4)CC3)c3noc4c3c2C(=O)c2ccccc2-4)c1 |
| InChI | InChI=1S/C31H26N4O4/c1-18-9-10-19(2)22(16-18)32-23-17-24(34-11-13-35(14-12-34)31(37)25-8-5-15-38-25)28-27-26(23)29(36)20-6-3-4-7-21(20)30(27)39-33-28/h3-10,15-17,32H,11-14H2,1-2H3 |
| InChIKey | LTNWVNPDHQVUPG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|