C32H27N5O6 — CID 46257119
10,12-bis[4-(furan-2-carbonyl)piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 46257119) has the molecular formula C32H27N5O6 and a molecular weight of 577.60 g/mol. Its IUPAC name is 10,12-bis[4-(furan-2-carbonyl)piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 10,12-bis[4-(furan-2-carbonyl)piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 46257119 |
| Molecular Formula | C32H27N5O6 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 10,12-bis[4-(furan-2-carbonyl)piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | O=C1c2ccccc2-c2onc3c(N4CCN(C(=O)c5ccco5)CC4)cc(N4CCN(C(=O)c5ccco5)CC4)c1c23 |
| InChI | InChI=1S/C32H27N5O6/c38-29-20-5-1-2-6-21(20)30-27-26(29)22(34-9-13-36(14-10-34)31(39)24-7-3-17-41-24)19-23(28(27)33-43-30)35-11-15-37(16-12-35)32(40)25-8-4-18-42-25/h1-8,17-19H,9-16H2 |
| InChIKey | MBDRXNQXEJUXQC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 116.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|