C31H28N4O9S2 — CID 171977750
3,6-bis[[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl]fluoren-9-one (PubChem CID 171977750) has the molecular formula C31H28N4O9S2 and a molecular weight of 664.72 g/mol. Its IUPAC name is 3,6-bis[[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl]fluoren-9-one.
| Compound Name | 3,6-bis[[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl]fluoren-9-one |
|---|---|
| PubChem CID | 171977750 |
| Molecular Formula | C31H28N4O9S2 |
| Molecular Weight | 664.72 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | 3,6-bis[[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl]fluoren-9-one |
| SMILES | O=C1c2ccc(S(=O)(=O)N3CCN(C(=O)c4ccco4)CC3)cc2-c2cc(S(=O)(=O)N3CCN(C(=O)c4ccco4)CC3)ccc21 |
| InChI | InChI=1S/C31H28N4O9S2/c36-29-23-7-5-21(45(39,40)34-13-9-32(10-14-34)30(37)27-3-1-17-43-27)19-25(23)26-20-22(6-8-24(26)29)46(41,42)35-15-11-33(12-16-35)31(38)28-4-2-18-44-28/h1-8,17-20H,9-16H2 |
| InChIKey | RCILNIUHDZXBCE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 158.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |