C13H14N4O6S — CID 16822023
5-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-1H-pyrimidine-2,4-dione (PubChem CID 16822023) has the molecular formula C13H14N4O6S and a molecular weight of 354.34 g/mol. Its IUPAC name is 5-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16822023 |
| Molecular Formula | C13H14N4O6S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 5-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1ccco1)N1CCN(S(=O)(=O)c2c[nH]c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C13H14N4O6S/c18-11-10(8-14-13(20)15-11)24(21,22)17-5-3-16(4-6-17)12(19)9-2-1-7-23-9/h1-2,7-8H,3-6H2,(H2,14,15,18,20) |
| InChIKey | WGPNCFAQVDPUHR-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |