C16H16F2N2O4S — CID 55823789
[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 55823789) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is [4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 55823789 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2ccc(S(=O)(=O)C(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H16F2N2O4S/c17-16(18)25(22,23)13-5-3-12(4-6-13)19-7-9-20(10-8-19)15(21)14-2-1-11-24-14/h1-6,11,16H,7-10H2 |
| InChIKey | ZGVSNAXIKZADEC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |