C31H31N5O4 — CID 58538907
4-[[12-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid (PubChem CID 58538907) has the molecular formula C31H31N5O4 and a molecular weight of 537.62 g/mol. Its IUPAC name is 4-[[12-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid.
| Compound Name | 4-[[12-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 58538907 |
| Molecular Formula | C31H31N5O4 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 4-[[12-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid |
| SMILES | CN1CCC(N2CCN(c3cc(Nc4ccc(C(=O)O)cc4)c4c5c(onc35)-c3ccccc3C4=O)CC2)CC1 |
| InChI | InChI=1S/C31H31N5O4/c1-34-12-10-21(11-13-34)35-14-16-36(17-15-35)25-18-24(32-20-8-6-19(7-9-20)31(38)39)26-27-28(25)33-40-30(27)23-5-3-2-4-22(23)29(26)37/h2-9,18,21,32H,10-17H2,1H3,(H,38,39) |
| InChIKey | JSTINVLFYWCNRF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|