C29H25N3O6 — CID 15997531
4-[[12-(4-ethoxycarbonylpiperidin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid (PubChem CID 15997531) has the molecular formula C29H25N3O6 and a molecular weight of 511.53 g/mol. Its IUPAC name is 4-[[12-(4-ethoxycarbonylpiperidin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid.
| Compound Name | 4-[[12-(4-ethoxycarbonylpiperidin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 15997531 |
| Molecular Formula | C29H25N3O6 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 4-[[12-(4-ethoxycarbonylpiperidin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid |
| SMILES | CCOC(=O)C1CCN(c2cc(Nc3ccc(C(=O)O)cc3)c3c4c(onc24)-c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C29H25N3O6/c1-2-37-29(36)17-11-13-32(14-12-17)22-15-21(30-18-9-7-16(8-10-18)28(34)35)23-24-25(22)31-38-27(24)20-6-4-3-5-19(20)26(23)33/h3-10,15,17,30H,2,11-14H2,1H3,(H,34,35) |
| InChIKey | VWXRUZKKHXLMPE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|