C28H31N3O4 — CID 20868041
ethyl 1-[10-(cyclohexylamino)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylate (PubChem CID 20868041) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is ethyl 1-[10-(cyclohexylamino)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[10-(cyclohexylamino)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 20868041 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | ethyl 1-[10-(cyclohexylamino)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2cc(NC3CCCCC3)c3c4c(onc24)-c2ccccc2C3=O)C1 |
| InChI | InChI=1S/C28H31N3O4/c1-2-34-28(33)17-9-8-14-31(16-17)22-15-21(29-18-10-4-3-5-11-18)23-24-25(22)30-35-27(24)20-13-7-6-12-19(20)26(23)32/h6-7,12-13,15,17-18,29H,2-5,8-11,14,16H2,1H3 |
| InChIKey | RUZORJSXLYVTJK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|