C31H31N3O7 — CID 98182793
ethyl (3S)-1-[8-oxo-10-(3,4,5-trimethoxyanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylate (PubChem CID 98182793) has the molecular formula C31H31N3O7 and a molecular weight of 557.60 g/mol. Its IUPAC name is ethyl (3S)-1-[8-oxo-10-(3,4,5-trimethoxyanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[8-oxo-10-(3,4,5-trimethoxyanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98182793 |
| Molecular Formula | C31H31N3O7 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | ethyl (3S)-1-[8-oxo-10-(3,4,5-trimethoxyanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2cc(Nc3cc(OC)c(OC)c(OC)c3)c3c4c(onc24)-c2ccccc2C3=O)C1 |
| InChI | InChI=1S/C31H31N3O7/c1-5-40-31(36)17-9-8-12-34(16-17)22-15-21(32-18-13-23(37-2)30(39-4)24(14-18)38-3)25-26-27(22)33-41-29(26)20-11-7-6-10-19(20)28(25)35/h6-7,10-11,13-15,17,32H,5,8-9,12,16H2,1-4H3/t17-/m0/s1 |
| InChIKey | XTIAHCSDZSJEDG-KRWDZBQOSA-N |
| XLogP | 5.59 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|