C26H21N3O10S2 — CID 146385444
(3S)-1-[10-(2,5-disulfoanilino)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylic acid (PubChem CID 146385444) has the molecular formula C26H21N3O10S2 and a molecular weight of 599.60 g/mol. Its IUPAC name is (3S)-1-[10-(2,5-disulfoanilino)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[10-(2,5-disulfoanilino)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 146385444 |
| Molecular Formula | C26H21N3O10S2 |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.07 |
| IUPAC Name | (3S)-1-[10-(2,5-disulfoanilino)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-12-yl]piperidine-3-carboxylic acid |
| SMILES | O=C1c2ccccc2-c2onc3c(N4CCC[C@H](C(=O)O)C4)cc(Nc4cc(S(=O)(=O)O)ccc4S(=O)(=O)O)c1c23 |
| InChI | InChI=1S/C26H21N3O10S2/c30-24-15-5-1-2-6-16(15)25-22-21(24)18(27-17-10-14(40(33,34)35)7-8-20(17)41(36,37)38)11-19(23(22)28-39-25)29-9-3-4-13(12-29)26(31)32/h1-2,5-8,10-11,13,27H,3-4,9,12H2,(H,31,32)(H,33,34,35)(H,36,37,38)/t13-/m0/s1 |
| InChIKey | GWYLZFWMZGLJAV-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 204.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|