C36H34N4O7 — CID 46504393
methyl 4-[[8-oxo-12-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate (PubChem CID 46504393) has the molecular formula C36H34N4O7 and a molecular weight of 634.69 g/mol. Its IUPAC name is methyl 4-[[8-oxo-12-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate.
| Compound Name | methyl 4-[[8-oxo-12-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
|---|---|
| PubChem CID | 46504393 |
| Molecular Formula | C36H34N4O7 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | methyl 4-[[8-oxo-12-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cc(N3CCN(Cc4ccc(OC)c(OC)c4OC)CC3)c3noc4c3c2C(=O)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C36H34N4O7/c1-43-28-14-11-22(33(44-2)35(28)45-3)20-39-15-17-40(18-16-39)27-19-26(37-23-12-9-21(10-13-23)36(42)46-4)29-30-31(27)38-47-34(30)25-8-6-5-7-24(25)32(29)41/h5-14,19,37H,15-18,20H2,1-4H3 |
| InChIKey | WNAFWFAPJANEGW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|