C22H18N2O3 — CID 142876904
1-amino-4-[4-(2-hydroxyethyl)anilino]anthracene-9,10-dione (PubChem CID 142876904) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-amino-4-[4-(2-hydroxyethyl)anilino]anthracene-9,10-dione.
| Compound Name | 1-amino-4-[4-(2-hydroxyethyl)anilino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 142876904 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-amino-4-[4-(2-hydroxyethyl)anilino]anthracene-9,10-dione |
| SMILES | Nc1ccc(Nc2ccc(CCO)cc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H18N2O3/c23-17-9-10-18(24-14-7-5-13(6-8-14)11-12-25)20-19(17)21(26)15-3-1-2-4-16(15)22(20)27/h1-10,24-25H,11-12,23H2 |
| InChIKey | PPEWHDHWLAZZSG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|