C46H39BrN2O8 — CID 163912926
2-(4-aminophenyl)ethanol;1-bromo-4-methoxyanthracene-9,10-dione;1-[4-(2-hydroxyethyl)anilino]-4-methoxyanthracene-9,10-dione (PubChem CID 163912926) has the molecular formula C46H39BrN2O8 and a molecular weight of 827.73 g/mol. Its IUPAC name is 2-(4-aminophenyl)ethanol;1-bromo-4-methoxyanthracene-9,10-dione;1-[4-(2-hydroxyethyl)anilino]-4-methoxyanthracene-9,10-dione.
| Compound Name | 2-(4-aminophenyl)ethanol;1-bromo-4-methoxyanthracene-9,10-dione;1-[4-(2-hydroxyethyl)anilino]-4-methoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 163912926 |
| Molecular Formula | C46H39BrN2O8 |
| Molecular Weight | 827.73 g/mol |
| Exact Mass | 826.19 |
| IUPAC Name | 2-(4-aminophenyl)ethanol;1-bromo-4-methoxyanthracene-9,10-dione;1-[4-(2-hydroxyethyl)anilino]-4-methoxyanthracene-9,10-dione |
| SMILES | COc1ccc(Br)c2c1C(=O)c1ccccc1C2=O.COc1ccc(Nc2ccc(CCO)cc2)c2c1C(=O)c1ccccc1C2=O.Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C23H19NO4.C15H9BrO3.C8H11NO/c1-28-19-11-10-18(24-15-8-6-14(7-9-15)12-13-25)20-21(19)23(27)17-5-3-2-4-16(17)22(20)26;1-19-11-7-6-10(16)12-13(11)15(18)9-5-3-2-4-8(9)14(12)17;9-8-3-1-7(2-4-8)5-6-10/h2-11,24-25H,12-13H2,1H3;2-7H,1H3;1-4,10H,5-6,9H2 |
| InChIKey | QTSVXFSBTYXDFE-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.73 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|