C52H43Br2N3O7 — CID 163983045
2-(4-aminophenyl)ethanol;2,7-bis[4-(2-hydroxyethyl)anilino]anthracene-9,10-dione;2,7-dibromoanthracene-9,10-dione (PubChem CID 163983045) has the molecular formula C52H43Br2N3O7 and a molecular weight of 981.74 g/mol. Its IUPAC name is 2-(4-aminophenyl)ethanol;2,7-bis[4-(2-hydroxyethyl)anilino]anthracene-9,10-dione;2,7-dibromoanthracene-9,10-dione.
| Compound Name | 2-(4-aminophenyl)ethanol;2,7-bis[4-(2-hydroxyethyl)anilino]anthracene-9,10-dione;2,7-dibromoanthracene-9,10-dione |
|---|---|
| PubChem CID | 163983045 |
| Molecular Formula | C52H43Br2N3O7 |
| Molecular Weight | 981.74 g/mol |
| Exact Mass | 979.15 |
| IUPAC Name | 2-(4-aminophenyl)ethanol;2,7-bis[4-(2-hydroxyethyl)anilino]anthracene-9,10-dione;2,7-dibromoanthracene-9,10-dione |
| SMILES | Nc1ccc(CCO)cc1.O=C1c2ccc(Br)cc2C(=O)c2cc(Br)ccc21.O=C1c2ccc(Nc3ccc(CCO)cc3)cc2C(=O)c2cc(Nc3ccc(CCO)cc3)ccc21 |
| InChI | InChI=1S/C30H26N2O4.C14H6Br2O2.C8H11NO/c33-15-13-19-1-5-21(6-2-19)31-23-9-11-25-27(17-23)30(36)28-18-24(10-12-26(28)29(25)35)32-22-7-3-20(4-8-22)14-16-34;15-7-1-3-9-11(5-7)14(18)12-6-8(16)2-4-10(12)13(9)17;9-8-3-1-7(2-4-8)5-6-10/h1-12,17-18,31-34H,13-16H2;1-6H;1-4,10H,5-6,9H2 |
| InChIKey | TTWWCFSKYKBBFI-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.74 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|