C50H62Br2N2O10 — CID 158260503
2,6-dibromoanthracene-9,10-dione;2-(6,6-dimethoxyhexyl)-6-(5,5-dimethoxypentylamino)anthracene-9,10-dione;5,5-dimethoxypentan-1-amine (PubChem CID 158260503) has the molecular formula C50H62Br2N2O10 and a molecular weight of 1010.86 g/mol. Its IUPAC name is 2,6-dibromoanthracene-9,10-dione;2-(6,6-dimethoxyhexyl)-6-(5,5-dimethoxypentylamino)anthracene-9,10-dione;5,5-dimethoxypentan-1-amine.
| Compound Name | 2,6-dibromoanthracene-9,10-dione;2-(6,6-dimethoxyhexyl)-6-(5,5-dimethoxypentylamino)anthracene-9,10-dione;5,5-dimethoxypentan-1-amine |
|---|---|
| PubChem CID | 158260503 |
| Molecular Formula | C50H62Br2N2O10 |
| Molecular Weight | 1010.86 g/mol |
| Exact Mass | 1008.28 |
| IUPAC Name | 2,6-dibromoanthracene-9,10-dione;2-(6,6-dimethoxyhexyl)-6-(5,5-dimethoxypentylamino)anthracene-9,10-dione;5,5-dimethoxypentan-1-amine |
| SMILES | COC(CCCCCc1ccc2c(c1)C(=O)c1ccc(NCCCCC(OC)OC)cc1C2=O)OC.COC(CCCCN)OC.O=C1c2ccc(Br)cc2C(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C29H39NO6.C14H6Br2O2.C7H17NO2/c1-33-26(34-2)11-7-5-6-10-20-13-15-22-24(18-20)28(31)23-16-14-21(19-25(23)29(22)32)30-17-9-8-12-27(35-3)36-4;15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17;1-9-7(10-2)5-3-4-6-8/h13-16,18-19,26-27,30H,5-12,17H2,1-4H3;1-6H;7H,3-6,8H2,1-2H3 |
| InChIKey | GHUVWXDVSGZDBN-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.86 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|