C13H21BrN2O2 — CID 174301576
N'-(3-bromophenyl)-N-(2,2-dimethoxyethyl)propane-1,3-diamine (PubChem CID 174301576) has the molecular formula C13H21BrN2O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is N'-(3-bromophenyl)-N-(2,2-dimethoxyethyl)propane-1,3-diamine.
| Compound Name | N'-(3-bromophenyl)-N-(2,2-dimethoxyethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 174301576 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N'-(3-bromophenyl)-N-(2,2-dimethoxyethyl)propane-1,3-diamine |
| SMILES | COC(CNCCCNc1cccc(Br)c1)OC |
| InChI | InChI=1S/C13H21BrN2O2/c1-17-13(18-2)10-15-7-4-8-16-12-6-3-5-11(14)9-12/h3,5-6,9,13,15-16H,4,7-8,10H2,1-2H3 |
| InChIKey | SBUFZYOWZHSNOQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|