C17H20N2O3 — CID 177396001
2-(4-aminophenyl)ethyl N-[4-(2-hydroxyethyl)phenyl]carbamate (PubChem CID 177396001) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(4-aminophenyl)ethyl N-[4-(2-hydroxyethyl)phenyl]carbamate.
| Compound Name | 2-(4-aminophenyl)ethyl N-[4-(2-hydroxyethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 177396001 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-(4-aminophenyl)ethyl N-[4-(2-hydroxyethyl)phenyl]carbamate |
| SMILES | Nc1ccc(CCOC(=O)Nc2ccc(CCO)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O3/c18-15-5-1-14(2-6-15)10-12-22-17(21)19-16-7-3-13(4-8-16)9-11-20/h1-8,20H,9-12,18H2,(H,19,21) |
| InChIKey | SRUPXOXOLRORBL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|