C12H16N2O4 — CID 79346307
2-hydroxyethyl N-[4-(propanoylamino)phenyl]carbamate (PubChem CID 79346307) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-hydroxyethyl N-[4-(propanoylamino)phenyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[4-(propanoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 79346307 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-hydroxyethyl N-[4-(propanoylamino)phenyl]carbamate |
| SMILES | CCC(=O)Nc1ccc(NC(=O)OCCO)cc1 |
| InChI | InChI=1S/C12H16N2O4/c1-2-11(16)13-9-3-5-10(6-4-9)14-12(17)18-8-7-15/h3-6,15H,2,7-8H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | JEDICFKXOTWWDE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |