C12H16N2O5 — CID 79346016
2-hydroxyethyl N-[4-(2-hydroxyethylcarbamoyl)phenyl]carbamate (PubChem CID 79346016) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-hydroxyethyl N-[4-(2-hydroxyethylcarbamoyl)phenyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[4-(2-hydroxyethylcarbamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 79346016 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-hydroxyethyl N-[4-(2-hydroxyethylcarbamoyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(C(=O)NCCO)cc1)OCCO |
| InChI | InChI=1S/C12H16N2O5/c15-6-5-13-11(17)9-1-3-10(4-2-9)14-12(18)19-8-7-16/h1-4,15-16H,5-8H2,(H,13,17)(H,14,18) |
| InChIKey | DHLOFENLRYRCCL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |