C11H15N3O3 — CID 43710446
4-[(2-aminoacetyl)amino]-N-(2-hydroxyethyl)benzamide (PubChem CID 43710446) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-[(2-aminoacetyl)amino]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-[(2-aminoacetyl)amino]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 43710446 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-[(2-aminoacetyl)amino]-N-(2-hydroxyethyl)benzamide |
| SMILES | NCC(=O)Nc1ccc(C(=O)NCCO)cc1 |
| InChI | InChI=1S/C11H15N3O3/c12-7-10(16)14-9-3-1-8(2-4-9)11(17)13-5-6-15/h1-4,15H,5-7,12H2,(H,13,17)(H,14,16) |
| InChIKey | PKNQZJBGNPTSIB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |