C10H14N2O5S — CID 79345608
2-hydroxyethyl N-[4-(sulfamoylmethyl)phenyl]carbamate (PubChem CID 79345608) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-hydroxyethyl N-[4-(sulfamoylmethyl)phenyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[4-(sulfamoylmethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 79345608 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-hydroxyethyl N-[4-(sulfamoylmethyl)phenyl]carbamate |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)OCCO)cc1 |
| InChI | InChI=1S/C10H14N2O5S/c11-18(15,16)7-8-1-3-9(4-2-8)12-10(14)17-6-5-13/h1-4,13H,5-7H2,(H,12,14)(H2,11,15,16) |
| InChIKey | CLILTOLNSPLWST-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |