About 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate
2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate (PubChem CID 54414116) has the molecular formula C19H22N2O4
and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate |
| PubChem CID | 54414116 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate |
| SMILES | O=CNc1ccc(CCCc2ccc(NC(=O)OCCO)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O4/c22-12-13-25-19(24)21-18-10-6-16(7-11-18)3-1-2-15-4-8-17(9-5-15)20-14-23/h4-11,14,22H,1-3,12-13H2,(H,20,23)(H,21,24) |
| InChIKey | YZVPGHVSLZSIQQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate?
The IUPAC name of 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate (CID 54414116) is 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate.
What is the SMILES notation for 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate?
The canonical SMILES for 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate is O=CNc1ccc(CCCc2ccc(NC(=O)OCCO)cc2)cc1.
What is the InChIKey of 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate?
The InChIKey is YZVPGHVSLZSIQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O4/c22-12-13-25-19(24)21-18-10-6-16(7-11-18)3-1-2-15-4-8-17(9-5-15)20-14-23/h4-11,14,22H,1-3,12-13H2,(H,20,23)(H,21,24).
What are the key properties of 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate?
2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate has a molecular weight of 342.40 g/mol, XLogP of 2.97, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-[4-[3-(4-formamidophenyl)propyl]phenyl]carbamate is sourced from PubChem (CID 54414116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).