C12H19ClN2O2 — CID 24836337
3-methylbutyl N-(4-aminophenyl)carbamate;hydrochloride (PubChem CID 24836337) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 3-methylbutyl N-(4-aminophenyl)carbamate;hydrochloride.
| Compound Name | 3-methylbutyl N-(4-aminophenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 24836337 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-methylbutyl N-(4-aminophenyl)carbamate;hydrochloride |
| SMILES | CC(C)CCOC(=O)Nc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C12H18N2O2.ClH/c1-9(2)7-8-16-12(15)14-11-5-3-10(13)4-6-11;/h3-6,9H,7-8,13H2,1-2H3,(H,14,15);1H |
| InChIKey | SGNPADGFDRXMRT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|