C36H44F4N2O6 — CID 18801574
6-methylheptyl N-[4-[2,3,5,6-tetrafluoro-4-[4-(6-methylheptoxycarbonylamino)phenoxy]phenoxy]phenyl]carbamate (PubChem CID 18801574) has the molecular formula C36H44F4N2O6 and a molecular weight of 676.75 g/mol. Its IUPAC name is 6-methylheptyl N-[4-[2,3,5,6-tetrafluoro-4-[4-(6-methylheptoxycarbonylamino)phenoxy]phenoxy]phenyl]carbamate.
| Compound Name | 6-methylheptyl N-[4-[2,3,5,6-tetrafluoro-4-[4-(6-methylheptoxycarbonylamino)phenoxy]phenoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 18801574 |
| Molecular Formula | C36H44F4N2O6 |
| Molecular Weight | 676.75 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | 6-methylheptyl N-[4-[2,3,5,6-tetrafluoro-4-[4-(6-methylheptoxycarbonylamino)phenoxy]phenoxy]phenyl]carbamate |
| SMILES | CC(C)CCCCCOC(=O)Nc1ccc(Oc2c(F)c(F)c(Oc3ccc(NC(=O)OCCCCCC(C)C)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C36H44F4N2O6/c1-23(2)11-7-5-9-21-45-35(43)41-25-13-17-27(18-14-25)47-33-29(37)31(39)34(32(40)30(33)38)48-28-19-15-26(16-20-28)42-36(44)46-22-10-6-8-12-24(3)4/h13-20,23-24H,5-12,21-22H2,1-4H3,(H,41,43)(H,42,44) |
| InChIKey | ZGXDYJHCOZIGIB-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.75 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|