C15H19F4NO2 — CID 134251417
5-methylhexyl N-[4-fluoro-2-(trifluoromethyl)phenyl]carbamate (PubChem CID 134251417) has the molecular formula C15H19F4NO2 and a molecular weight of 321.31 g/mol. Its IUPAC name is 5-methylhexyl N-[4-fluoro-2-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 5-methylhexyl N-[4-fluoro-2-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 134251417 |
| Molecular Formula | C15H19F4NO2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 5-methylhexyl N-[4-fluoro-2-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)CCCCOC(=O)Nc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H19F4NO2/c1-10(2)5-3-4-8-22-14(21)20-13-7-6-11(16)9-12(13)15(17,18)19/h6-7,9-10H,3-5,8H2,1-2H3,(H,20,21) |
| InChIKey | NBJIUGWKAMIUCD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|