C24H22F4N4O4 — CID 18801582
3-[4-[4-[4-(dimethylcarbamoylamino)phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]-1,1-dimethylurea (PubChem CID 18801582) has the molecular formula C24H22F4N4O4 and a molecular weight of 506.46 g/mol. Its IUPAC name is 3-[4-[4-[4-(dimethylcarbamoylamino)phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[4-[4-(dimethylcarbamoylamino)phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 18801582 |
| Molecular Formula | C24H22F4N4O4 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 3-[4-[4-[4-(dimethylcarbamoylamino)phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(Oc2c(F)c(F)c(Oc3ccc(NC(=O)N(C)C)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H22F4N4O4/c1-31(2)23(33)29-13-5-9-15(10-6-13)35-21-17(25)19(27)22(20(28)18(21)26)36-16-11-7-14(8-12-16)30-24(34)32(3)4/h5-12H,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | JRXSNSOOCYBTEC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|