C25H22N2O3 — CID 3089345
N-(4-amino-9,10-dioxoanthracen-1-yl)-4-butylbenzamide (PubChem CID 3089345) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-(4-amino-9,10-dioxoanthracen-1-yl)-4-butylbenzamide.
| Compound Name | N-(4-amino-9,10-dioxoanthracen-1-yl)-4-butylbenzamide |
|---|---|
| PubChem CID | 3089345 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(4-amino-9,10-dioxoanthracen-1-yl)-4-butylbenzamide |
| SMILES | CCCCc1ccc(C(=O)Nc2ccc(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-2-3-6-15-9-11-16(12-10-15)25(30)27-20-14-13-19(26)21-22(20)24(29)18-8-5-4-7-17(18)23(21)28/h4-5,7-14H,2-3,6,26H2,1H3,(H,27,30) |
| InChIKey | LPOOZMRQGXOGQU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|