C33H36N2O3 — CID 154281218
N-(9,10-dioxo-4-piperidin-1-ylanthracen-1-yl)-4-heptylbenzamide (PubChem CID 154281218) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is N-(9,10-dioxo-4-piperidin-1-ylanthracen-1-yl)-4-heptylbenzamide.
| Compound Name | N-(9,10-dioxo-4-piperidin-1-ylanthracen-1-yl)-4-heptylbenzamide |
|---|---|
| PubChem CID | 154281218 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | N-(9,10-dioxo-4-piperidin-1-ylanthracen-1-yl)-4-heptylbenzamide |
| SMILES | CCCCCCCc1ccc(C(=O)Nc2ccc(N3CCCCC3)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C33H36N2O3/c1-2-3-4-5-7-12-23-15-17-24(18-16-23)33(38)34-27-19-20-28(35-21-10-6-11-22-35)30-29(27)31(36)25-13-8-9-14-26(25)32(30)37/h8-9,13-20H,2-7,10-12,21-22H2,1H3,(H,34,38) |
| InChIKey | KEDUHKXDURHSRF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|