C62H66N2O6 — CID 6303044
[4-[(E)-2-(4-butylphenyl)ethenyl]-3-methylphenyl] 1,4-bis[(4-heptylbenzoyl)amino]-9,10-dioxoanthracene-2-carboxylate (PubChem CID 6303044) has the molecular formula C62H66N2O6 and a molecular weight of 935.22 g/mol. Its IUPAC name is [4-[(E)-2-(4-butylphenyl)ethenyl]-3-methylphenyl] 1,4-bis[(4-heptylbenzoyl)amino]-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [4-[(E)-2-(4-butylphenyl)ethenyl]-3-methylphenyl] 1,4-bis[(4-heptylbenzoyl)amino]-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 6303044 |
| Molecular Formula | C62H66N2O6 |
| Molecular Weight | 935.22 g/mol |
| Exact Mass | 934.49 |
| IUPAC Name | [4-[(E)-2-(4-butylphenyl)ethenyl]-3-methylphenyl] 1,4-bis[(4-heptylbenzoyl)amino]-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCCCCCCc1ccc(C(=O)Nc2cc(C(=O)Oc3ccc(/C=C/c4ccc(CCCC)cc4)c(C)c3)c(NC(=O)c3ccc(CCCCCCC)cc3)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C62H66N2O6/c1-5-8-11-13-15-20-44-29-34-48(35-30-44)60(67)63-54-41-53(62(69)70-50-39-38-47(42(4)40-50)33-28-46-26-24-43(25-27-46)19-10-7-3)57(56-55(54)58(65)51-22-17-18-23-52(51)59(56)66)64-61(68)49-36-31-45(32-37-49)21-16-14-12-9-6-2/h17-18,22-41H,5-16,19-21H2,1-4H3,(H,63,67)(H,64,68)/b33-28+ |
| InChIKey | LJQUCLFXSYFGMW-PJJLUWSFSA-N |
| XLogP | 15.03 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.22 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|