C26H17NO2S — CID 154117825
1-anilino-4-phenylsulfanylanthracene-9,10-dione (PubChem CID 154117825) has the molecular formula C26H17NO2S and a molecular weight of 407.49 g/mol. Its IUPAC name is 1-anilino-4-phenylsulfanylanthracene-9,10-dione.
| Compound Name | 1-anilino-4-phenylsulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 154117825 |
| Molecular Formula | C26H17NO2S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 1-anilino-4-phenylsulfanylanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(Sc3ccccc3)ccc(Nc3ccccc3)c21 |
| InChI | InChI=1S/C26H17NO2S/c28-25-19-13-7-8-14-20(19)26(29)24-22(30-18-11-5-2-6-12-18)16-15-21(23(24)25)27-17-9-3-1-4-10-17/h1-16,27H |
| InChIKey | NNWKGAAVRVDIQS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|