C25H19NO3S — CID 142149922
(E)-N-(9,10-dioxo-4-phenylsulfanylanthracen-1-yl)-2-methylbut-2-enamide (PubChem CID 142149922) has the molecular formula C25H19NO3S and a molecular weight of 413.50 g/mol. Its IUPAC name is (E)-N-(9,10-dioxo-4-phenylsulfanylanthracen-1-yl)-2-methylbut-2-enamide.
| Compound Name | (E)-N-(9,10-dioxo-4-phenylsulfanylanthracen-1-yl)-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 142149922 |
| Molecular Formula | C25H19NO3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (E)-N-(9,10-dioxo-4-phenylsulfanylanthracen-1-yl)-2-methylbut-2-enamide |
| SMILES | C/C=C(\C)C(=O)Nc1ccc(Sc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H19NO3S/c1-3-15(2)25(29)26-19-13-14-20(30-16-9-5-4-6-10-16)22-21(19)23(27)17-11-7-8-12-18(17)24(22)28/h3-14H,1-2H3,(H,26,29)/b15-3+ |
| InChIKey | UYYMXOPOBSHJDY-CRKCGEKBSA-N |
| XLogP | 5.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|