C28H18BrNO3S — CID 23400792
N-(7-bromo-9,10-dioxo-4-phenylsulfanylanthracen-1-yl)-4-methylbenzamide (PubChem CID 23400792) has the molecular formula C28H18BrNO3S and a molecular weight of 528.43 g/mol. Its IUPAC name is N-(7-bromo-9,10-dioxo-4-phenylsulfanylanthracen-1-yl)-4-methylbenzamide.
| Compound Name | N-(7-bromo-9,10-dioxo-4-phenylsulfanylanthracen-1-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 23400792 |
| Molecular Formula | C28H18BrNO3S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | N-(7-bromo-9,10-dioxo-4-phenylsulfanylanthracen-1-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Sc3ccccc3)c3c2C(=O)c2cc(Br)ccc2C3=O)cc1 |
| InChI | InChI=1S/C28H18BrNO3S/c1-16-7-9-17(10-8-16)28(33)30-22-13-14-23(34-19-5-3-2-4-6-19)25-24(22)27(32)21-15-18(29)11-12-20(21)26(25)31/h2-15H,1H3,(H,30,33) |
| InChIKey | YROAWKVDZONIJB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|