C54H31Cl3N2O6S2 — CID 161004204
3-chloro-N-(9,10-dioxo-4-phenylsulfanylanthracen-1-yl)benzamide;N-[4-(2,5-dichlorophenyl)sulfanyl-9,10-dioxoanthracen-1-yl]benzamide (PubChem CID 161004204) has the molecular formula C54H31Cl3N2O6S2 and a molecular weight of 974.34 g/mol. Its IUPAC name is 3-chloro-N-(9,10-dioxo-4-phenylsulfanylanthracen-1-yl)benzamide;N-[4-(2,5-dichlorophenyl)sulfanyl-9,10-dioxoanthracen-1-yl]benzamide.
| Compound Name | 3-chloro-N-(9,10-dioxo-4-phenylsulfanylanthracen-1-yl)benzamide;N-[4-(2,5-dichlorophenyl)sulfanyl-9,10-dioxoanthracen-1-yl]benzamide |
|---|---|
| PubChem CID | 161004204 |
| Molecular Formula | C54H31Cl3N2O6S2 |
| Molecular Weight | 974.34 g/mol |
| Exact Mass | 972.07 |
| IUPAC Name | 3-chloro-N-(9,10-dioxo-4-phenylsulfanylanthracen-1-yl)benzamide;N-[4-(2,5-dichlorophenyl)sulfanyl-9,10-dioxoanthracen-1-yl]benzamide |
| SMILES | O=C(Nc1ccc(Sc2cc(Cl)ccc2Cl)c2c1C(=O)c1ccccc1C2=O)c1ccccc1.O=C(Nc1ccc(Sc2ccccc2)c2c1C(=O)c1ccccc1C2=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H15Cl2NO3S.C27H16ClNO3S/c28-16-10-11-19(29)22(14-16)34-21-13-12-20(30-27(33)15-6-2-1-3-7-15)23-24(21)26(32)18-9-5-4-8-17(18)25(23)31;28-17-8-6-7-16(15-17)27(32)29-21-13-14-22(33-18-9-2-1-3-10-18)24-23(21)25(30)19-11-4-5-12-20(19)26(24)31/h1-14H,(H,30,33);1-15H,(H,29,32) |
| InChIKey | TWHDQQUSOWJYEC-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.34 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|