C30H24ClNO3S — CID 142235918
3-chloro-N-(4-cyclohepta-1,3,5-trien-1-ylsulfanyl-9,10-dioxoanthracen-1-yl)benzamide;ethane (PubChem CID 142235918) has the molecular formula C30H24ClNO3S and a molecular weight of 514.05 g/mol. Its IUPAC name is 3-chloro-N-(4-cyclohepta-1,3,5-trien-1-ylsulfanyl-9,10-dioxoanthracen-1-yl)benzamide;ethane.
| Compound Name | 3-chloro-N-(4-cyclohepta-1,3,5-trien-1-ylsulfanyl-9,10-dioxoanthracen-1-yl)benzamide;ethane |
|---|---|
| PubChem CID | 142235918 |
| Molecular Formula | C30H24ClNO3S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 3-chloro-N-(4-cyclohepta-1,3,5-trien-1-ylsulfanyl-9,10-dioxoanthracen-1-yl)benzamide;ethane |
| SMILES | CC.O=C(Nc1ccc(SC2=CC=CC=CC2)c2c1C(=O)c1ccccc1C2=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H18ClNO3S.C2H6/c29-18-9-7-8-17(16-18)28(33)30-22-14-15-23(34-19-10-3-1-2-4-11-19)25-24(22)26(31)20-12-5-6-13-21(20)27(25)32;1-2/h1-10,12-16H,11H2,(H,30,33);1-2H3 |
| InChIKey | SRMLQQFCTGQOMJ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|