C24H15Cl2NO4 — CID 58408344
3-chloro-N-[2-(3-chloro-2-oxopropyl)-9,10-dioxoanthracen-1-yl]benzamide (PubChem CID 58408344) has the molecular formula C24H15Cl2NO4 and a molecular weight of 452.29 g/mol. Its IUPAC name is 3-chloro-N-[2-(3-chloro-2-oxopropyl)-9,10-dioxoanthracen-1-yl]benzamide.
| Compound Name | 3-chloro-N-[2-(3-chloro-2-oxopropyl)-9,10-dioxoanthracen-1-yl]benzamide |
|---|---|
| PubChem CID | 58408344 |
| Molecular Formula | C24H15Cl2NO4 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 3-chloro-N-[2-(3-chloro-2-oxopropyl)-9,10-dioxoanthracen-1-yl]benzamide |
| SMILES | O=C(CCl)Cc1ccc2c(c1NC(=O)c1cccc(Cl)c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H15Cl2NO4/c25-12-16(28)11-13-8-9-19-20(23(30)18-7-2-1-6-17(18)22(19)29)21(13)27-24(31)14-4-3-5-15(26)10-14/h1-10H,11-12H2,(H,27,31) |
| InChIKey | KIHKFJSIOPPNRS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|