C40H26N2O6S2 — CID 23498209
2-[4,5-dianilino-8-(2-carboxyphenyl)sulfanyl-9,10-dioxoanthracen-1-yl]sulfanylbenzoic acid (PubChem CID 23498209) has the molecular formula C40H26N2O6S2 and a molecular weight of 694.79 g/mol. Its IUPAC name is 2-[4,5-dianilino-8-(2-carboxyphenyl)sulfanyl-9,10-dioxoanthracen-1-yl]sulfanylbenzoic acid.
| Compound Name | 2-[4,5-dianilino-8-(2-carboxyphenyl)sulfanyl-9,10-dioxoanthracen-1-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 23498209 |
| Molecular Formula | C40H26N2O6S2 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.12 |
| IUPAC Name | 2-[4,5-dianilino-8-(2-carboxyphenyl)sulfanyl-9,10-dioxoanthracen-1-yl]sulfanylbenzoic acid |
| SMILES | O=C(O)c1ccccc1Sc1ccc(Nc2ccccc2)c2c1C(=O)c1c(Sc3ccccc3C(=O)O)ccc(Nc3ccccc3)c1C2=O |
| InChI | InChI=1S/C40H26N2O6S2/c43-37-33-27(41-23-11-3-1-4-12-23)19-21-31(49-29-17-9-7-15-25(29)39(45)46)35(33)38(44)36-32(50-30-18-10-8-16-26(30)40(47)48)22-20-28(34(36)37)42-24-13-5-2-6-14-24/h1-22,41-42H,(H,45,46)(H,47,48) |
| InChIKey | MZPSTIKGNJKELU-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|