C23H17BrN2O6 — CID 158998141
5-[(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)amino]benzene-1,3-dicarboxylic acid;methane (PubChem CID 158998141) has the molecular formula C23H17BrN2O6 and a molecular weight of 497.30 g/mol. Its IUPAC name is 5-[(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)amino]benzene-1,3-dicarboxylic acid;methane.
| Compound Name | 5-[(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)amino]benzene-1,3-dicarboxylic acid;methane |
|---|---|
| PubChem CID | 158998141 |
| Molecular Formula | C23H17BrN2O6 |
| Molecular Weight | 497.30 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 5-[(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)amino]benzene-1,3-dicarboxylic acid;methane |
| SMILES | C.Nc1c(Br)cc(Nc2cc(C(=O)O)cc(C(=O)O)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H13BrN2O6.CH4/c23-14-8-15(25-11-6-9(21(28)29)5-10(7-11)22(30)31)16-17(18(14)24)20(27)13-4-2-1-3-12(13)19(16)26;/h1-8,25H,24H2,(H,28,29)(H,30,31);1H4 |
| InChIKey | JQZSNUURIUWYJT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|