C28H23N5O14S4 — CID 135979741
7-[[3-hydroxy-4-[[1-hydroxy-7-(2-sulfoethylamino)-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]phenyl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid (PubChem CID 135979741) has the molecular formula C28H23N5O14S4 and a molecular weight of 781.78 g/mol. Its IUPAC name is 7-[[3-hydroxy-4-[[1-hydroxy-7-(2-sulfoethylamino)-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]phenyl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid.
| Compound Name | 7-[[3-hydroxy-4-[[1-hydroxy-7-(2-sulfoethylamino)-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]phenyl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135979741 |
| Molecular Formula | C28H23N5O14S4 |
| Molecular Weight | 781.78 g/mol |
| Exact Mass | 781.01 |
| IUPAC Name | 7-[[3-hydroxy-4-[[1-hydroxy-7-(2-sulfoethylamino)-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]phenyl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCNc1ccc2cc(SOOO)c(/N=N/c3ccc(/N=N/c4ccc5cc(SOOO)cc(S(=O)(=O)O)c5c4)cc3O)c(O)c2c1 |
| InChI | InChI=1S/C28H23N5O14S4/c34-24-13-19(31-30-18-4-2-15-9-20(48-46-44-36)14-26(21(15)12-18)51(41,42)43)5-6-23(24)32-33-27-25(49-47-45-37)10-16-1-3-17(11-22(16)28(27)35)29-7-8-50(38,39)40/h1-6,9-14,29,34-37H,7-8H2,(H,38,39,40)(H,41,42,43)/b31-30+,33-32+ |
| InChIKey | MSFOWOUHEJAAGZ-CJQWSLHQSA-N |
| XLogP | 7.64 |
| TPSA | 288.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.78 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|