C25H19CuN5O17S4 — CID 135980680
5-acetamido-2-[[1,8-dihydroxy-3-sulfo-7-[[2-sulfo-5-(trioxidanylsulfanyl)phenyl]diazenyl]-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]benzoic acid;copper (PubChem CID 135980680) has the molecular formula C25H19CuN5O17S4 and a molecular weight of 853.26 g/mol. Its IUPAC name is 5-acetamido-2-[[1,8-dihydroxy-3-sulfo-7-[[2-sulfo-5-(trioxidanylsulfanyl)phenyl]diazenyl]-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]benzoic acid;copper.
| Compound Name | 5-acetamido-2-[[1,8-dihydroxy-3-sulfo-7-[[2-sulfo-5-(trioxidanylsulfanyl)phenyl]diazenyl]-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]benzoic acid;copper |
|---|---|
| PubChem CID | 135980680 |
| Molecular Formula | C25H19CuN5O17S4 |
| Molecular Weight | 853.26 g/mol |
| Exact Mass | 851.90 |
| IUPAC Name | 5-acetamido-2-[[1,8-dihydroxy-3-sulfo-7-[[2-sulfo-5-(trioxidanylsulfanyl)phenyl]diazenyl]-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]benzoic acid;copper |
| SMILES | CC(=O)Nc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(SOOO)c(/N=N/c4cc(SOOO)ccc4S(=O)(=O)O)c(O)c3c2O)c(C(=O)O)c1.[Cu] |
| InChI | InChI=1S/C25H19N5O17S4.Cu/c1-10(31)26-12-2-4-15(14(8-12)25(34)35)27-30-22-19(51(41,42)43)7-11-6-17(49-47-45-37)21(23(32)20(11)24(22)33)29-28-16-9-13(48-46-44-36)3-5-18(16)50(38,39)40;/h2-9,32-33,36-37H,1H3,(H,26,31)(H,34,35)(H,38,39,40)(H,41,42,43);/b29-28+,30-27+; |
| InChIKey | PMLOCVXLJNKYRO-YLARIQIBSA-N |
| XLogP | 6.09 |
| TPSA | 342.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.26 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|