C29H25N5O13S3 — CID 135962562
3-amino-6-[[4-[[3-(2,3-dihydroxypropoxy)phenyl]diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135962562) has the molecular formula C29H25N5O13S3 and a molecular weight of 747.74 g/mol. Its IUPAC name is 3-amino-6-[[4-[[3-(2,3-dihydroxypropoxy)phenyl]diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 3-amino-6-[[4-[[3-(2,3-dihydroxypropoxy)phenyl]diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135962562 |
| Molecular Formula | C29H25N5O13S3 |
| Molecular Weight | 747.74 g/mol |
| Exact Mass | 747.06 |
| IUPAC Name | 3-amino-6-[[4-[[3-(2,3-dihydroxypropoxy)phenyl]diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | Nc1cc2c(O)c(/N=N/c3ccc(/N=N/c4cccc(OCC(O)CO)c4)c4ccc(S(=O)(=O)O)cc34)c(SOOO)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C29H25N5O13S3/c30-23-12-21-15(9-27(23)50(42,43)44)8-26(48-47-46-38)28(29(21)37)34-33-25-7-6-24(20-5-4-19(11-22(20)25)49(39,40)41)32-31-16-2-1-3-18(10-16)45-14-17(36)13-35/h1-12,17,35-38H,13-14,30H2,(H,39,40,41)(H,42,43,44)/b32-31+,34-33+ |
| InChIKey | FNANZARUWWCHFG-HSBKYFPUSA-N |
| XLogP | 5.77 |
| TPSA | 292.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.74 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|