C24H26N6O7S2 — CID 136652704
4-[(4,6-dimethyl-1,3,5-triazin-2-yl)-methylamino]-5-hydroxy-6-phenyldiazenyl-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;ethane (PubChem CID 136652704) has the molecular formula C24H26N6O7S2 and a molecular weight of 574.64 g/mol. Its IUPAC name is 4-[(4,6-dimethyl-1,3,5-triazin-2-yl)-methylamino]-5-hydroxy-6-phenyldiazenyl-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;ethane.
| Compound Name | 4-[(4,6-dimethyl-1,3,5-triazin-2-yl)-methylamino]-5-hydroxy-6-phenyldiazenyl-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;ethane |
|---|---|
| PubChem CID | 136652704 |
| Molecular Formula | C24H26N6O7S2 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 4-[(4,6-dimethyl-1,3,5-triazin-2-yl)-methylamino]-5-hydroxy-6-phenyldiazenyl-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;ethane |
| SMILES | CC.Cc1nc(C)nc(N(C)c2cc(S(=O)(=O)O)cc3cc(SOOO)c(/N=N/c4ccccc4)c(O)c23)n1 |
| InChI | InChI=1S/C22H20N6O7S2.C2H6/c1-12-23-13(2)25-22(24-12)28(3)17-11-16(37(31,32)33)9-14-10-18(36-35-34-30)20(21(29)19(14)17)27-26-15-7-5-4-6-8-15;1-2/h4-11,29-30H,1-3H3,(H,31,32,33);1-2H3/b27-26+; |
| InChIKey | MINNWVZAMDNJTH-JGUILPGDSA-N |
| XLogP | 6.23 |
| TPSA | 179.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|