C24H17N3O16S4 — CID 165367348
4-[[7-[(1,5-disulfonaphthalen-2-yl)diazenyl]-8-hydroxy-3,6-disulfonaphthalen-1-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 165367348) has the molecular formula C24H17N3O16S4 and a molecular weight of 731.67 g/mol. Its IUPAC name is 4-[[7-[(1,5-disulfonaphthalen-2-yl)diazenyl]-8-hydroxy-3,6-disulfonaphthalen-1-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[7-[(1,5-disulfonaphthalen-2-yl)diazenyl]-8-hydroxy-3,6-disulfonaphthalen-1-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 165367348 |
| Molecular Formula | C24H17N3O16S4 |
| Molecular Weight | 731.67 g/mol |
| Exact Mass | 730.95 |
| IUPAC Name | 4-[[7-[(1,5-disulfonaphthalen-2-yl)diazenyl]-8-hydroxy-3,6-disulfonaphthalen-1-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc4c(S(=O)(=O)O)cccc4c3S(=O)(=O)O)c(O)c12 |
| InChI | InChI=1S/C24H17N3O16S4/c28-19(6-7-20(29)30)25-16-10-12(44(32,33)34)8-11-9-18(46(38,39)40)22(23(31)21(11)16)27-26-15-5-4-13-14(24(15)47(41,42)43)2-1-3-17(13)45(35,36)37/h1-10,31H,(H,25,28)(H,29,30)(H,32,33,34)(H,35,36,37)(H,38,39,40)(H,41,42,43)/b7-6?,27-26+ |
| InChIKey | FGIPLWAWRAFLMM-XEIXRAOLSA-N |
| XLogP | 2.68 |
| TPSA | 328.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.67 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|