C21H27N3O4S — CID 136622133
5-amino-4-hydroxy-6-[(2-methylphenyl)diazenyl]naphthalene-2-sulfonic acid;ethane (PubChem CID 136622133) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 5-amino-4-hydroxy-6-[(2-methylphenyl)diazenyl]naphthalene-2-sulfonic acid;ethane.
| Compound Name | 5-amino-4-hydroxy-6-[(2-methylphenyl)diazenyl]naphthalene-2-sulfonic acid;ethane |
|---|---|
| PubChem CID | 136622133 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 5-amino-4-hydroxy-6-[(2-methylphenyl)diazenyl]naphthalene-2-sulfonic acid;ethane |
| SMILES | CC.CC.Cc1ccccc1/N=N/c1ccc2cc(S(=O)(=O)O)cc(O)c2c1N |
| InChI | InChI=1S/C17H15N3O4S.2C2H6/c1-10-4-2-3-5-13(10)19-20-14-7-6-11-8-12(25(22,23)24)9-15(21)16(11)17(14)18;2*1-2/h2-9,21H,18H2,1H3,(H,22,23,24);2*1-2H3/b20-19+;; |
| InChIKey | CGKMSCUSXQSXTA-LLIZZRELSA-N |
| XLogP | 6.15 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|