C18H20N4O5S — CID 157271428
2-[(6,7-diamino-1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]-5-methylbenzenesulfonic acid;hydrate (PubChem CID 157271428) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-[(6,7-diamino-1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]-5-methylbenzenesulfonic acid;hydrate.
| Compound Name | 2-[(6,7-diamino-1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]-5-methylbenzenesulfonic acid;hydrate |
|---|---|
| PubChem CID | 157271428 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[(6,7-diamino-1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]-5-methylbenzenesulfonic acid;hydrate |
| SMILES | Cc1ccc(/N=N/c2c(C)cc3cc(N)c(N)cc3c2O)c(S(=O)(=O)O)c1.O |
| InChI | InChI=1S/C18H18N4O4S.H2O/c1-9-3-4-15(16(5-9)27(24,25)26)21-22-17-10(2)6-11-7-13(19)14(20)8-12(11)18(17)23;/h3-8,23H,19-20H2,1-2H3,(H,24,25,26);1H2/b22-21+; |
| InChIKey | FZAQDMGESLOVPO-QUABFQRHSA-N |
| XLogP | 3.16 |
| TPSA | 182.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|