C32H26N8O6S2 — CID 160978939
2,4-diamino-3-[[4-[4-[(1,3-diamino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 160978939) has the molecular formula C32H26N8O6S2 and a molecular weight of 682.74 g/mol. Its IUPAC name is 2,4-diamino-3-[[4-[4-[(1,3-diamino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 2,4-diamino-3-[[4-[4-[(1,3-diamino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 160978939 |
| Molecular Formula | C32H26N8O6S2 |
| Molecular Weight | 682.74 g/mol |
| Exact Mass | 682.14 |
| IUPAC Name | 2,4-diamino-3-[[4-[4-[(1,3-diamino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4c(N)c(S(=O)(=O)O)c5ccccc5c4N)cc3)cc2)c(N)c2ccccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C32H26N8O6S2/c33-25-21-5-1-3-7-23(21)31(47(41,42)43)27(35)29(25)39-37-19-13-9-17(10-14-19)18-11-15-20(16-12-18)38-40-30-26(34)22-6-2-4-8-24(22)32(28(30)36)48(44,45)46/h1-16H,33-36H2,(H,41,42,43)(H,44,45,46)/b39-37+,40-38+ |
| InChIKey | SZGGXBPEYOFLOP-HVMBLDELSA-N |
| XLogP | 7.31 |
| TPSA | 262.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|