C34H30N8O6S4 — CID 161217733
2,4-diamino-3-[[4-[4-[(1,3-diamino-4-sulfonaphthalen-2-yl)diazenyl]-3-methylsulfanylphenyl]-2-(sulfanylmethyl)phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 161217733) has the molecular formula C34H30N8O6S4 and a molecular weight of 774.93 g/mol. Its IUPAC name is 2,4-diamino-3-[[4-[4-[(1,3-diamino-4-sulfonaphthalen-2-yl)diazenyl]-3-methylsulfanylphenyl]-2-(sulfanylmethyl)phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 2,4-diamino-3-[[4-[4-[(1,3-diamino-4-sulfonaphthalen-2-yl)diazenyl]-3-methylsulfanylphenyl]-2-(sulfanylmethyl)phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 161217733 |
| Molecular Formula | C34H30N8O6S4 |
| Molecular Weight | 774.93 g/mol |
| Exact Mass | 774.12 |
| IUPAC Name | 2,4-diamino-3-[[4-[4-[(1,3-diamino-4-sulfonaphthalen-2-yl)diazenyl]-3-methylsulfanylphenyl]-2-(sulfanylmethyl)phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | CSc1cc(-c2ccc(/N=N/c3c(N)c(S(=O)(=O)O)c4ccccc4c3N)c(CS)c2)ccc1/N=N/c1c(N)c(S(=O)(=O)O)c2ccccc2c1N |
| InChI | InChI=1S/C34H30N8O6S4/c1-50-26-15-18(11-13-25(26)40-42-32-28(36)21-7-3-5-9-23(21)34(30(32)38)52(46,47)48)17-10-12-24(19(14-17)16-49)39-41-31-27(35)20-6-2-4-8-22(20)33(29(31)37)51(43,44)45/h2-15,49H,16,35-38H2,1H3,(H,43,44,45)(H,46,47,48)/b41-39+,42-40+ |
| InChIKey | UXCBNFZJVXKLAG-LMXNTIJMSA-N |
| XLogP | 8.46 |
| TPSA | 262.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.93 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|