C26H21F3N4O4S3 — CID 166725600
3-[[4-(4-amino-3-methylsulfanylphenyl)-2-methylsulfanylphenyl]diazenyl]-4-[(2,2,2-trifluoroacetyl)amino]naphthalene-1-sulfonic acid (PubChem CID 166725600) has the molecular formula C26H21F3N4O4S3 and a molecular weight of 606.67 g/mol. Its IUPAC name is 3-[[4-(4-amino-3-methylsulfanylphenyl)-2-methylsulfanylphenyl]diazenyl]-4-[(2,2,2-trifluoroacetyl)amino]naphthalene-1-sulfonic acid.
| Compound Name | 3-[[4-(4-amino-3-methylsulfanylphenyl)-2-methylsulfanylphenyl]diazenyl]-4-[(2,2,2-trifluoroacetyl)amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 166725600 |
| Molecular Formula | C26H21F3N4O4S3 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | 3-[[4-(4-amino-3-methylsulfanylphenyl)-2-methylsulfanylphenyl]diazenyl]-4-[(2,2,2-trifluoroacetyl)amino]naphthalene-1-sulfonic acid |
| SMILES | CSc1cc(-c2ccc(/N=N/c3cc(S(=O)(=O)O)c4ccccc4c3NC(=O)C(F)(F)F)c(SC)c2)ccc1N |
| InChI | InChI=1S/C26H21F3N4O4S3/c1-38-21-11-14(7-9-18(21)30)15-8-10-19(22(12-15)39-2)32-33-20-13-23(40(35,36)37)16-5-3-4-6-17(16)24(20)31-25(34)26(27,28)29/h3-13H,30H2,1-2H3,(H,31,34)(H,35,36,37)/b33-32+ |
| InChIKey | HEZZAPZVZPZPGC-ULIFNZDWSA-N |
| XLogP | 7.70 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|